C30H39FN6O4 — CID 126679446
(2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[(2S)-3-methyl-2-[(4-phenylbenzoyl)amino]butanoyl]pyrrolidine-2-carboxamide (PubChem CID 126679446) has the molecular formula C30H39FN6O4 and a molecular weight of 566.68 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[(2S)-3-methyl-2-[(4-phenylbenzoyl)amino]butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[(2S)-3-methyl-2-[(4-phenylbenzoyl)amino]butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126679446 |
| Molecular Formula | C30H39FN6O4 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | (2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[(2S)-3-methyl-2-[(4-phenylbenzoyl)amino]butanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C30H39FN6O4/c1-19(2)26(36-27(39)22-14-12-21(13-15-22)20-8-4-3-5-9-20)29(41)37-17-7-11-24(37)28(40)35-23(25(38)18-31)10-6-16-34-30(32)33/h3-5,8-9,12-15,19,23-24,26H,6-7,10-11,16-18H2,1-2H3,(H,35,40)(H,36,39)(H4,32,33,34)/t23-,24-,26-/m0/s1 |
| InChIKey | DTPSSAYSOBSZSI-GNKBHMEESA-N |
| XLogP | 2.18 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|