C25H36ClFN6O5 — CID 126679727
(2-chlorophenyl)methyl N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 126679727) has the molecular formula C25H36ClFN6O5 and a molecular weight of 555.05 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | (2-chlorophenyl)methyl N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 126679727 |
| Molecular Formula | C25H36ClFN6O5 |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (2-chlorophenyl)methyl N-[(2S)-1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1Cl)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C25H36ClFN6O5/c1-15(2)21(32-25(37)38-14-16-7-3-4-8-17(16)26)23(36)33-12-6-10-19(33)22(35)31-18(20(34)13-27)9-5-11-30-24(28)29/h3-4,7-8,15,18-19,21H,5-6,9-14H2,1-2H3,(H,31,35)(H,32,37)(H4,28,29,30)/t18-,19-,21-/m0/s1 |
| InChIKey | SIAMIUBSJJIBIX-ZJOUEHCJSA-N |
| XLogP | 1.66 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|