C12H20N2 — CID 126679736
(1Z,3E,5Z,7E)-1-N,2-N,3-trimethylnona-1,3,5,7-tetraene-1,2-diamine (PubChem CID 126679736) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (1Z,3E,5Z,7E)-1-N,2-N,3-trimethylnona-1,3,5,7-tetraene-1,2-diamine.
| Compound Name | (1Z,3E,5Z,7E)-1-N,2-N,3-trimethylnona-1,3,5,7-tetraene-1,2-diamine |
|---|---|
| PubChem CID | 126679736 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (1Z,3E,5Z,7E)-1-N,2-N,3-trimethylnona-1,3,5,7-tetraene-1,2-diamine |
| SMILES | C/C=C/C=C\C=C(C)\C(=C\NC)NC |
| InChI | InChI=1S/C12H20N2/c1-5-6-7-8-9-11(2)12(14-4)10-13-3/h5-10,13-14H,1-4H3/b6-5+,8-7-,11-9+,12-10- |
| InChIKey | PMRNLVJKQWRXOC-RWLZAMNUSA-N |
| XLogP | 2.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|