About 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine
7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine (PubChem CID 126679808) has the molecular formula C16H19BrN4O
and a molecular weight of 363.26 g/mol. Its IUPAC name is 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine.
Molecular Properties
| Compound Name | 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine |
| PubChem CID | 126679808 |
| Molecular Formula | C16H19BrN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine |
| SMILES | CN1CCN(Cc2cn3c(n2)COc2cc(Br)ccc2-3)CC1 |
| InChI | InChI=1S/C16H19BrN4O/c1-19-4-6-20(7-5-19)9-13-10-21-14-3-2-12(17)8-15(14)22-11-16(21)18-13/h2-3,8,10H,4-7,9,11H2,1H3 |
| InChIKey | DWBQCHLZYDGTAB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine?
The IUPAC name of 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine (CID 126679808) is 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine.
What is the SMILES notation for 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine?
The canonical SMILES for 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine is CN1CCN(Cc2cn3c(n2)COc2cc(Br)ccc2-3)CC1.
What is the InChIKey of 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine?
The InChIKey is DWBQCHLZYDGTAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN4O/c1-19-4-6-20(7-5-19)9-13-10-21-14-3-2-12(17)8-15(14)22-11-16(21)18-13/h2-3,8,10H,4-7,9,11H2,1H3.
What are the key properties of 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine?
7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine has a molecular weight of 363.26 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-[(4-methylpiperazin-1-yl)methyl]-4H-imidazo[2,1-c][1,4]benzoxazine is sourced from PubChem (CID 126679808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).