About 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine
7-methyl-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 126679868) has the molecular formula C6H7N5
and a molecular weight of 149.16 g/mol. Its IUPAC name is 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine |
| PubChem CID | 126679868 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Cc1cc(N)nc2n[nH]nc12 |
| InChI | InChI=1S/C6H7N5/c1-3-2-4(7)8-6-5(3)9-11-10-6/h2H,1H3,(H3,7,8,9,10,11) |
| InChIKey | HLBRXRDBQYPYNV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine?
The IUPAC name of 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine (CID 126679868) is 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine?
The canonical SMILES for 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine is Cc1cc(N)nc2n[nH]nc12.
What is the InChIKey of 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine?
The InChIKey is HLBRXRDBQYPYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5/c1-3-2-4(7)8-6-5(3)9-11-10-6/h2H,1H3,(H3,7,8,9,10,11).
What are the key properties of 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine?
7-methyl-2H-triazolo[4,5-b]pyridin-5-amine has a molecular weight of 149.16 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2H-triazolo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 126679868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).