C11H13NO2 — CID 12668030
3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-dione (PubChem CID 12668030) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-dione.
| Compound Name | 3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-dione |
|---|---|
| PubChem CID | 12668030 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-methyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-dione |
| SMILES | CN1CCC2=CC(=O)C(=O)C=C2CC1 |
| InChI | InChI=1S/C11H13NO2/c1-12-4-2-8-6-10(13)11(14)7-9(8)3-5-12/h6-7H,2-5H2,1H3 |
| InChIKey | BXSLUMFKRMBPRJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|