C12H19NO — CID 126680323
[3-[(Z)-prop-1-enyl]-2,3,3a,6,7,7a-hexahydro-1-benzofuran-2-yl]methanamine (PubChem CID 126680323) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is [3-[(Z)-prop-1-enyl]-2,3,3a,6,7,7a-hexahydro-1-benzofuran-2-yl]methanamine.
| Compound Name | [3-[(Z)-prop-1-enyl]-2,3,3a,6,7,7a-hexahydro-1-benzofuran-2-yl]methanamine |
|---|---|
| PubChem CID | 126680323 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [3-[(Z)-prop-1-enyl]-2,3,3a,6,7,7a-hexahydro-1-benzofuran-2-yl]methanamine |
| SMILES | C/C=C\C1C(CN)OC2CCC=CC21 |
| InChI | InChI=1S/C12H19NO/c1-2-5-9-10-6-3-4-7-11(10)14-12(9)8-13/h2-3,5-6,9-12H,4,7-8,13H2,1H3/b5-2- |
| InChIKey | POKFQIPGNXHZIN-DJWKRKHSSA-N |
| XLogP | 1.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|