C17H20BrNO2S — CID 12668037
3-methyl-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide (PubChem CID 12668037) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is 3-methyl-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide.
| Compound Name | 3-methyl-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
|---|---|
| PubChem CID | 12668037 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3-methyl-6-phenylsulfanyl-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol;hydrobromide |
| SMILES | Br.CN1CCc2cc(O)c(O)c(Sc3ccccc3)c2CC1 |
| InChI | InChI=1S/C17H19NO2S.BrH/c1-18-9-7-12-11-15(19)16(20)17(14(12)8-10-18)21-13-5-3-2-4-6-13;/h2-6,11,19-20H,7-10H2,1H3;1H |
| InChIKey | QNYLUARCYAZETH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|