C27H38BrFN6O5 — CID 126680464
(2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-2-cyclohexylacetyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 126680464) has the molecular formula C27H38BrFN6O5 and a molecular weight of 625.54 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-2-cyclohexylacetyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-2-cyclohexylacetyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126680464 |
| Molecular Formula | C27H38BrFN6O5 |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-2-cyclohexylacetyl]-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](NC(=O)c1ccc(Br)cc1)C1CCCCC1)C(=O)CF |
| InChI | InChI=1S/C27H38BrFN6O5/c28-18-10-8-17(9-11-18)24(38)34-23(16-5-2-1-3-6-16)26(40)35-15-19(36)13-21(35)25(39)33-20(22(37)14-29)7-4-12-32-27(30)31/h8-11,16,19-21,23,36H,1-7,12-15H2,(H,33,39)(H,34,38)(H4,30,31,32)/t19-,20+,21+,23+/m1/s1 |
| InChIKey | SEXKBOMUHGLYNV-FBPBVXOASA-N |
| XLogP | 1.17 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|