C24H36BrFN6O5 — CID 126680483
(2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 126680483) has the molecular formula C24H36BrFN6O5 and a molecular weight of 587.49 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126680483 |
| Molecular Formula | C24H36BrFN6O5 |
| Molecular Weight | 587.49 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoyl]-N-[(3S)-6-(diaminomethylamino)-1-fluoro-2-oxohexan-3-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Br)cc1)C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](CCCNC(N)N)C(=O)CF |
| InChI | InChI=1S/C24H36BrFN6O5/c1-13(2)20(31-21(35)14-5-7-15(25)8-6-14)23(37)32-12-16(33)10-18(32)22(36)30-17(19(34)11-26)4-3-9-29-24(27)28/h5-8,13,16-18,20,24,29,33H,3-4,9-12,27-28H2,1-2H3,(H,30,36)(H,31,35)/t16-,17+,18+,20+/m1/s1 |
| InChIKey | SDCMDDZWNXEKMB-LXZJYRNTSA-N |
| XLogP | -0.24 |
| TPSA | 179.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.49 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|