About (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine
(3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine (PubChem CID 126680851) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine |
| PubChem CID | 126680851 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine |
| SMILES | C=CC(=C)N(C)C(=C)/C=C\CCC |
| InChI | InChI=1S/C12H19N/c1-6-8-9-10-12(4)13(5)11(3)7-2/h7,9-10H,2-4,6,8H2,1,5H3/b10-9- |
| InChIKey | QJKDERVRIIACMA-KTKRTIGZSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine?
The IUPAC name of (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine (CID 126680851) is (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine.
What is the SMILES notation for (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine?
The canonical SMILES for (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine is C=CC(=C)N(C)C(=C)/C=C\CCC.
What is the InChIKey of (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine?
The InChIKey is QJKDERVRIIACMA-KTKRTIGZSA-N. The full InChI is InChI=1S/C12H19N/c1-6-8-9-10-12(4)13(5)11(3)7-2/h7,9-10H,2-4,6,8H2,1,5H3/b10-9-.
What are the key properties of (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine?
(3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine has a molecular weight of 177.29 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-buta-1,3-dien-2-yl-N-methylhepta-1,3-dien-2-amine is sourced from PubChem (CID 126680851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).