C15H22N2S — CID 126680970
6-tert-butyl-5-(2,3-dimethylbut-3-en-2-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 126680970) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 6-tert-butyl-5-(2,3-dimethylbut-3-en-2-yl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-tert-butyl-5-(2,3-dimethylbut-3-en-2-yl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 126680970 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-tert-butyl-5-(2,3-dimethylbut-3-en-2-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | C=C(C)C(C)(C)c1c(C(C)(C)C)nc2sccn12 |
| InChI | InChI=1S/C15H22N2S/c1-10(2)15(6,7)12-11(14(3,4)5)16-13-17(12)8-9-18-13/h8-9H,1H2,2-7H3 |
| InChIKey | XDBOKQJYKSOCHC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|