C19H19N5 — CID 126681989
11-methyltriphenylene-2,3,6,7,10-pentamine (PubChem CID 126681989) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 11-methyltriphenylene-2,3,6,7,10-pentamine.
| Compound Name | 11-methyltriphenylene-2,3,6,7,10-pentamine |
|---|---|
| PubChem CID | 126681989 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 11-methyltriphenylene-2,3,6,7,10-pentamine |
| SMILES | Cc1cc2c(cc1N)c1cc(N)c(N)cc1c1cc(N)c(N)cc21 |
| InChI | InChI=1S/C19H19N5/c1-8-2-9-10(3-15(8)20)12-5-17(22)19(24)7-14(12)13-6-18(23)16(21)4-11(9)13/h2-7H,20-24H2,1H3 |
| InChIKey | VBFYRKVGNBQMAI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|