C14H16F4N2O — CID 126682360
3-[(4R,5R,6S)-6-(1,1-difluoroethyl)-5-fluoro-2,4-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoroaniline (PubChem CID 126682360) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is 3-[(4R,5R,6S)-6-(1,1-difluoroethyl)-5-fluoro-2,4-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoroaniline.
| Compound Name | 3-[(4R,5R,6S)-6-(1,1-difluoroethyl)-5-fluoro-2,4-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 126682360 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[(4R,5R,6S)-6-(1,1-difluoroethyl)-5-fluoro-2,4-dimethyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoroaniline |
| SMILES | CC1=N[C@](C)(c2cc(N)ccc2F)[C@@H](F)[C@@H](C(C)(F)F)O1 |
| InChI | InChI=1S/C14H16F4N2O/c1-7-20-13(2,9-6-8(19)4-5-10(9)15)11(16)12(21-7)14(3,17)18/h4-6,11-12H,19H2,1-3H3/t11-,12-,13+/m0/s1 |
| InChIKey | IMKQNDSDASWTSP-RWMBFGLXSA-N |
| XLogP | 3.43 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|