C31H36FNO8 — CID 126682399
(2S,3R,4S,5R,6R)-2-[6-(diethylamino)-4-(fluoromethyl)-9-methoxy-9-phenylxanthen-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 126682399) has the molecular formula C31H36FNO8 and a molecular weight of 569.63 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[6-(diethylamino)-4-(fluoromethyl)-9-methoxy-9-phenylxanthen-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[6-(diethylamino)-4-(fluoromethyl)-9-methoxy-9-phenylxanthen-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 126682399 |
| Molecular Formula | C31H36FNO8 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[6-(diethylamino)-4-(fluoromethyl)-9-methoxy-9-phenylxanthen-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1c(ccc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c1CF)C2(OC)c1ccccc1 |
| InChI | InChI=1S/C31H36FNO8/c1-4-33(5-2)19-11-12-21-24(15-19)39-29-20(16-32)23(40-30-28(37)27(36)26(35)25(17-34)41-30)14-13-22(29)31(21,38-3)18-9-7-6-8-10-18/h6-15,25-28,30,34-37H,4-5,16-17H2,1-3H3/t25-,26+,27+,28-,30-,31?/m1/s1 |
| InChIKey | IFWRFVULOMLBAR-JGANWENXSA-N |
| XLogP | 3.22 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |