C41H26N6 — CID 126682779
8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-phenyl-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 126682779) has the molecular formula C41H26N6 and a molecular weight of 602.70 g/mol. Its IUPAC name is 8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-phenyl-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-phenyl-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 126682779 |
| Molecular Formula | C41H26N6 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-phenyl-8,14,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(N4c5ccccc5-c5nc(-c6ccccc6)nc6cccc4c56)c3)n2)cc1 |
| InChI | InChI=1S/C41H26N6/c1-4-14-27(15-5-1)38-42-33-23-13-25-35-36(33)37(43-38)32-22-10-11-24-34(32)47(35)31-21-12-20-30(26-31)41-45-39(28-16-6-2-7-17-28)44-40(46-41)29-18-8-3-9-19-29/h1-26H |
| InChIKey | BQFIKOQUOMOXNT-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 67.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |