C12H16N4 — CID 126683336
4-methyl-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3,5-triazin-2-amine (PubChem CID 126683336) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-methyl-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-methyl-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 126683336 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-methyl-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3,5-triazin-2-amine |
| SMILES | C/C=C\C=C/C(=C\C)Nc1ncnc(C)n1 |
| InChI | InChI=1S/C12H16N4/c1-4-6-7-8-11(5-2)16-12-14-9-13-10(3)15-12/h4-9H,1-3H3,(H,13,14,15,16)/b6-4-,8-7-,11-5+ |
| InChIKey | XGJCDUKDUZNSAQ-DIMXEIQZSA-N |
| XLogP | 2.63 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|