C19H22ClF3N4O2 — CID 126683386
2-chloro-N-[(E)-3-methyl-2-morpholin-4-yl-4-[[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]but-3-enyl]benzamide (PubChem CID 126683386) has the molecular formula C19H22ClF3N4O2 and a molecular weight of 430.86 g/mol. Its IUPAC name is 2-chloro-N-[(E)-3-methyl-2-morpholin-4-yl-4-[[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]but-3-enyl]benzamide.
| Compound Name | 2-chloro-N-[(E)-3-methyl-2-morpholin-4-yl-4-[[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]but-3-enyl]benzamide |
|---|---|
| PubChem CID | 126683386 |
| Molecular Formula | C19H22ClF3N4O2 |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-chloro-N-[(E)-3-methyl-2-morpholin-4-yl-4-[[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]but-3-enyl]benzamide |
| SMILES | C=N/C(=N\C=C(/C)C(CNC(=O)c1ccccc1Cl)N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C19H22ClF3N4O2/c1-13(11-26-18(24-2)19(21,22)23)16(27-7-9-29-10-8-27)12-25-17(28)14-5-3-4-6-15(14)20/h3-6,11,16H,2,7-10,12H2,1H3,(H,25,28)/b13-11+,26-18- |
| InChIKey | CJPAIPAQXLVBRN-UCSQFRGQSA-N |
| XLogP | 3.34 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|