C21H25F3N8O5 — CID 126683916
[4-[4-[(4-aminopyrimidin-5-yl)oxymethyl]piperidin-1-yl]-6-[(1,1,1-trifluoro-4-hydroxybutan-2-yl)carbamoyl]pyrimidin-2-yl]oxymethyl cyanate (PubChem CID 126683916) has the molecular formula C21H25F3N8O5 and a molecular weight of 526.48 g/mol. Its IUPAC name is [4-[4-[(4-aminopyrimidin-5-yl)oxymethyl]piperidin-1-yl]-6-[(1,1,1-trifluoro-4-hydroxybutan-2-yl)carbamoyl]pyrimidin-2-yl]oxymethyl cyanate.
| Compound Name | [4-[4-[(4-aminopyrimidin-5-yl)oxymethyl]piperidin-1-yl]-6-[(1,1,1-trifluoro-4-hydroxybutan-2-yl)carbamoyl]pyrimidin-2-yl]oxymethyl cyanate |
|---|---|
| PubChem CID | 126683916 |
| Molecular Formula | C21H25F3N8O5 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [4-[4-[(4-aminopyrimidin-5-yl)oxymethyl]piperidin-1-yl]-6-[(1,1,1-trifluoro-4-hydroxybutan-2-yl)carbamoyl]pyrimidin-2-yl]oxymethyl cyanate |
| SMILES | N#COCOc1nc(C(=O)NC(CCO)C(F)(F)F)cc(N2CCC(COc3cncnc3N)CC2)n1 |
| InChI | InChI=1S/C21H25F3N8O5/c22-21(23,24)16(3-6-33)30-19(34)14-7-17(31-20(29-14)37-12-35-10-25)32-4-1-13(2-5-32)9-36-15-8-27-11-28-18(15)26/h7-8,11,13,16,33H,1-6,9,12H2,(H,30,34)(H2,26,27,28) |
| InChIKey | XDAFHKDOEBVYRJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|