About 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate
2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate (PubChem CID 126684003) has the molecular formula C7H10N2O6S
and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate |
| PubChem CID | 126684003 |
| Molecular Formula | C7H10N2O6S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate |
| SMILES | Cc1noc(CCOS(C)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H10N2O6S/c1-5-7(9(10)11)6(15-8-5)3-4-14-16(2,12)13/h3-4H2,1-2H3 |
| InChIKey | TVMWKWJNGZCKBC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 112.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate?
The IUPAC name of 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate (CID 126684003) is 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate.
What is the SMILES notation for 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate?
The canonical SMILES for 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate is Cc1noc(CCOS(C)(=O)=O)c1[N+](=O)[O-].
What is the InChIKey of 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate?
The InChIKey is TVMWKWJNGZCKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O6S/c1-5-7(9(10)11)6(15-8-5)3-4-14-16(2,12)13/h3-4H2,1-2H3.
What are the key properties of 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate?
2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate has a molecular weight of 250.23 g/mol, XLogP of 0.41, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethyl methanesulfonate is sourced from PubChem (CID 126684003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).