About 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide
2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide (PubChem CID 12668423) has the molecular formula C7H9Br2NOS
and a molecular weight of 315.03 g/mol. Its IUPAC name is 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide.
Molecular Properties
| Compound Name | 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide |
| PubChem CID | 12668423 |
| Molecular Formula | C7H9Br2NOS |
| Molecular Weight | 315.03 g/mol |
| Exact Mass | 312.88 |
| IUPAC Name | 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide |
| SMILES | Br.Cc1nc(C)c(C(=O)CBr)s1 |
| InChI | InChI=1S/C7H8BrNOS.BrH/c1-4-7(6(10)3-8)11-5(2)9-4;/h3H2,1-2H3;1H |
| InChIKey | DDZXUPVHLRSQPO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.03 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide?
The IUPAC name of 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide (CID 12668423) is 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide.
What is the SMILES notation for 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide?
The canonical SMILES for 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide is Br.Cc1nc(C)c(C(=O)CBr)s1.
What is the InChIKey of 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide?
The InChIKey is DDZXUPVHLRSQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNOS.BrH/c1-4-7(6(10)3-8)11-5(2)9-4;/h3H2,1-2H3;1H.
What are the key properties of 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide?
2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide has a molecular weight of 315.03 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone;hydrobromide is sourced from PubChem (CID 12668423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).