About [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate
[4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate (PubChem CID 126684329) has the molecular formula C19H17F2NS
and a molecular weight of 329.42 g/mol. Its IUPAC name is [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate.
Molecular Properties
| Compound Name | [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate |
| PubChem CID | 126684329 |
| Molecular Formula | C19H17F2NS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate |
| SMILES | N#CSc1c(F)cc(-c2ccc(C3CCCCC3)cc2)cc1F |
| InChI | InChI=1S/C19H17F2NS/c20-17-10-16(11-18(21)19(17)23-12-22)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-11,13H,1-5H2 |
| InChIKey | NSNWPVAQXGMOGO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate?
The IUPAC name of [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate (CID 126684329) is [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate.
What is the SMILES notation for [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate?
The canonical SMILES for [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate is N#CSc1c(F)cc(-c2ccc(C3CCCCC3)cc2)cc1F.
What is the InChIKey of [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate?
The InChIKey is NSNWPVAQXGMOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2NS/c20-17-10-16(11-18(21)19(17)23-12-22)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-11,13H,1-5H2.
What are the key properties of [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate?
[4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate has a molecular weight of 329.42 g/mol, XLogP of 6.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-cyclohexylphenyl)-2,6-difluorophenyl] thiocyanate is sourced from PubChem (CID 126684329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).