About [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide
[(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide (PubChem CID 126684350) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide.
Molecular Properties
| Compound Name | [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide |
| PubChem CID | 126684350 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide |
| SMILES | C=CC(=C)N/C=C\N(C)C#N |
| InChI | InChI=1S/C8H11N3/c1-4-8(2)10-5-6-11(3)7-9/h4-6,10H,1-2H2,3H3/b6-5- |
| InChIKey | RFABWNZZKUKUOL-WAYWQWQTSA-N |
| XLogP | 1.16 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide?
The IUPAC name of [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide (CID 126684350) is [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide.
What is the SMILES notation for [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide?
The canonical SMILES for [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide is C=CC(=C)N/C=C\N(C)C#N.
What is the InChIKey of [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide?
The InChIKey is RFABWNZZKUKUOL-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H11N3/c1-4-8(2)10-5-6-11(3)7-9/h4-6,10H,1-2H2,3H3/b6-5-.
What are the key properties of [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide?
[(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide has a molecular weight of 149.20 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-(buta-1,3-dien-2-ylamino)ethenyl]-methylcyanamide is sourced from PubChem (CID 126684350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).