About 7-chloro-1H-pyrazolo[5,4-c]pyridine
7-chloro-1H-pyrazolo[5,4-c]pyridine (PubChem CID 12668491) has the molecular formula C6H4ClN3
and a molecular weight of 153.57 g/mol. Its IUPAC name is 7-chloro-1H-pyrazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 7-chloro-1H-pyrazolo[5,4-c]pyridine |
|---|
| PubChem CID | 12668491 |
|---|
| Molecular Formula | C6H4ClN3 |
|---|
| Molecular Weight | 153.57 g/mol |
|---|
| Exact Mass | 153.01 |
|---|
| IUPAC Name | 7-chloro-1H-pyrazolo[5,4-c]pyridine |
|---|
| SMILES | Clc1nccc2cn[nH]c12 |
|---|
| InChI | InChI=1S/C6H4ClN3/c7-6-5-4(1-2-8-6)3-9-10-5/h1-3H,(H,9,10) |
|---|
| InChIKey | LGYXPMDWRGMZCV-UHFFFAOYSA-N |
|---|
| XLogP | 1.61 |
|---|
| TPSA | 41.57 Ų |
|---|
| H-Bond Donors | 1 |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 153.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1H-pyrazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1H-pyrazolo[5,4-c]pyridine?
The IUPAC name of 7-chloro-1H-pyrazolo[5,4-c]pyridine (CID 12668491) is 7-chloro-1H-pyrazolo[5,4-c]pyridine.
What is the SMILES notation for 7-chloro-1H-pyrazolo[5,4-c]pyridine?
The canonical SMILES for 7-chloro-1H-pyrazolo[5,4-c]pyridine is Clc1nccc2cn[nH]c12.
What is the InChIKey of 7-chloro-1H-pyrazolo[5,4-c]pyridine?
The InChIKey is LGYXPMDWRGMZCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3/c7-6-5-4(1-2-8-6)3-9-10-5/h1-3H,(H,9,10).
What are the key properties of 7-chloro-1H-pyrazolo[5,4-c]pyridine?
7-chloro-1H-pyrazolo[5,4-c]pyridine has a molecular weight of 153.57 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1H-pyrazolo[5,4-c]pyridine is sourced from PubChem (CID 12668491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).