About 1-chloro-5,5-dimethylcyclohexene
1-chloro-5,5-dimethylcyclohexene (PubChem CID 12668510) has the molecular formula C8H13Cl
and a molecular weight of 144.65 g/mol. Its IUPAC name is 1-chloro-5,5-dimethylcyclohexene.
Molecular Properties
| Compound Name | 1-chloro-5,5-dimethylcyclohexene |
| PubChem CID | 12668510 |
| Molecular Formula | C8H13Cl |
| Molecular Weight | 144.65 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 1-chloro-5,5-dimethylcyclohexene |
| SMILES | CC1(C)CCC=C(Cl)C1 |
| InChI | InChI=1S/C8H13Cl/c1-8(2)5-3-4-7(9)6-8/h4H,3,5-6H2,1-2H3 |
| InChIKey | YAWJSHQHOZHFCI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-5,5-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5,5-dimethylcyclohexene?
The IUPAC name of 1-chloro-5,5-dimethylcyclohexene (CID 12668510) is 1-chloro-5,5-dimethylcyclohexene.
What is the SMILES notation for 1-chloro-5,5-dimethylcyclohexene?
The canonical SMILES for 1-chloro-5,5-dimethylcyclohexene is CC1(C)CCC=C(Cl)C1.
What is the InChIKey of 1-chloro-5,5-dimethylcyclohexene?
The InChIKey is YAWJSHQHOZHFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl/c1-8(2)5-3-4-7(9)6-8/h4H,3,5-6H2,1-2H3.
What are the key properties of 1-chloro-5,5-dimethylcyclohexene?
1-chloro-5,5-dimethylcyclohexene has a molecular weight of 144.65 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5,5-dimethylcyclohexene is sourced from PubChem (CID 12668510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).