C22H24O3S — CID 126685133
5-[3-[(2S,5R)-3-hydroxy-5-methyl-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 126685133) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 5-[3-[(2S,5R)-3-hydroxy-5-methyl-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2S,5R)-3-hydroxy-5-methyl-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 126685133 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 5-[3-[(2S,5R)-3-hydroxy-5-methyl-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | C[C@@H]1CC(O)[C@H](C#Cc2ccccc2)C1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C22H24O3S/c1-15-14-20(23)19(12-10-16-6-3-2-4-7-16)18(15)9-5-8-17-11-13-21(26-17)22(24)25/h2-4,6-7,11,13,15,18-20,23H,5,8-9,14H2,1H3,(H,24,25)/t15-,18?,19-,20?/m1/s1 |
| InChIKey | MANRBILSNQIJGE-GDBSJFFISA-N |
| XLogP | 4.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|