C22H24O4S — CID 126685136
methyl 5-[3-[(1R,2S,3R,5S)-3,5-dihydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 126685136) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2S,3R,5S)-3,5-dihydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2S,3R,5S)-3,5-dihydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 126685136 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | methyl 5-[3-[(1R,2S,3R,5S)-3,5-dihydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@@H]2[C@@H](C#Cc3ccccc3)[C@H](O)C[C@@H]2O)s1 |
| InChI | InChI=1S/C22H24O4S/c1-26-22(25)21-13-11-16(27-21)8-5-9-17-18(20(24)14-19(17)23)12-10-15-6-3-2-4-7-15/h2-4,6-7,11,13,17-20,23-24H,5,8-9,14H2,1H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | DXVXIICHTWZKGL-YSTOQKLRSA-N |
| XLogP | 3.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|