C29H31NO8 — CID 126685671
dibenzyl (2S,3R,4R)-2,4-dihydroxy-3-nitro-2-[(2R)-2-phenylbutyl]pentanedioate (PubChem CID 126685671) has the molecular formula C29H31NO8 and a molecular weight of 521.57 g/mol. Its IUPAC name is dibenzyl (2S,3R,4R)-2,4-dihydroxy-3-nitro-2-[(2R)-2-phenylbutyl]pentanedioate.
| Compound Name | dibenzyl (2S,3R,4R)-2,4-dihydroxy-3-nitro-2-[(2R)-2-phenylbutyl]pentanedioate |
|---|---|
| PubChem CID | 126685671 |
| Molecular Formula | C29H31NO8 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | dibenzyl (2S,3R,4R)-2,4-dihydroxy-3-nitro-2-[(2R)-2-phenylbutyl]pentanedioate |
| SMILES | CC[C@H](C[C@@](O)(C(=O)OCc1ccccc1)[C@@H]([C@@H](O)C(=O)OCc1ccccc1)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C29H31NO8/c1-2-23(24-16-10-5-11-17-24)18-29(34,28(33)38-20-22-14-8-4-9-15-22)26(30(35)36)25(31)27(32)37-19-21-12-6-3-7-13-21/h3-17,23,25-26,31,34H,2,18-20H2,1H3/t23-,25-,26-,29+/m1/s1 |
| InChIKey | QCOVYONIIIBMAZ-TXGFFYAOSA-N |
| XLogP | 3.79 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|