C18H22BrNO7 — CID 126685683
diethyl (1R,2S,5S)-5-(4-bromophenyl)-1-hydroxy-2-nitrocyclohexane-1,3-dicarboxylate (PubChem CID 126685683) has the molecular formula C18H22BrNO7 and a molecular weight of 444.28 g/mol. Its IUPAC name is diethyl (1R,2S,5S)-5-(4-bromophenyl)-1-hydroxy-2-nitrocyclohexane-1,3-dicarboxylate.
| Compound Name | diethyl (1R,2S,5S)-5-(4-bromophenyl)-1-hydroxy-2-nitrocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 126685683 |
| Molecular Formula | C18H22BrNO7 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | diethyl (1R,2S,5S)-5-(4-bromophenyl)-1-hydroxy-2-nitrocyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1C[C@H](c2ccc(Br)cc2)C[C@](O)(C(=O)OCC)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22BrNO7/c1-3-26-16(21)14-9-12(11-5-7-13(19)8-6-11)10-18(23,15(14)20(24)25)17(22)27-4-2/h5-8,12,14-15,23H,3-4,9-10H2,1-2H3/t12-,14?,15-,18+/m0/s1 |
| InChIKey | HSFVFBLKRUNZHF-DOMSSMHBSA-N |
| XLogP | 2.45 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|