C37H30N2S — CID 126685714
(4aR)-9-[8-[(2S)-3-ethenyl-2-[(Z)-prop-1-enyl]-2,3-dihydroindol-1-yl]dibenzothiophen-2-yl]-4a,9a-dihydrocarbazole (PubChem CID 126685714) has the molecular formula C37H30N2S and a molecular weight of 534.73 g/mol. Its IUPAC name is (4aR)-9-[8-[(2S)-3-ethenyl-2-[(Z)-prop-1-enyl]-2,3-dihydroindol-1-yl]dibenzothiophen-2-yl]-4a,9a-dihydrocarbazole.
| Compound Name | (4aR)-9-[8-[(2S)-3-ethenyl-2-[(Z)-prop-1-enyl]-2,3-dihydroindol-1-yl]dibenzothiophen-2-yl]-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 126685714 |
| Molecular Formula | C37H30N2S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (4aR)-9-[8-[(2S)-3-ethenyl-2-[(Z)-prop-1-enyl]-2,3-dihydroindol-1-yl]dibenzothiophen-2-yl]-4a,9a-dihydrocarbazole |
| SMILES | C=CC1c2ccccc2N(c2ccc3sc4ccc(N5c6ccccc6[C@H]6C=CC=CC65)cc4c3c2)[C@H]1/C=C\C |
| InChI | InChI=1S/C37H30N2S/c1-3-11-32-26(4-2)27-12-5-8-15-33(27)38(32)24-18-20-36-30(22-24)31-23-25(19-21-37(31)40-36)39-34-16-9-6-13-28(34)29-14-7-10-17-35(29)39/h3-23,26,28,32,34H,2H2,1H3/b11-3-/t26?,28-,32+,34?/m1/s1 |
| InChIKey | WECWRUJTAVKJJM-FFFGEJIRSA-N |
| XLogP | 10.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|