C14H32N2 — CID 126685858
2-(2,3-dimethylbutyl)-4,5-dimethylhexane-1,2-diamine (PubChem CID 126685858) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is 2-(2,3-dimethylbutyl)-4,5-dimethylhexane-1,2-diamine.
| Compound Name | 2-(2,3-dimethylbutyl)-4,5-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 126685858 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 2-(2,3-dimethylbutyl)-4,5-dimethylhexane-1,2-diamine |
| SMILES | CC(C)C(C)CC(N)(CN)CC(C)C(C)C |
| InChI | InChI=1S/C14H32N2/c1-10(2)12(5)7-14(16,9-15)8-13(6)11(3)4/h10-13H,7-9,15-16H2,1-6H3 |
| InChIKey | ZSJDQTLMJLYNIL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |