C20H21N3O7 — CID 126686246
[6-hydroxy-15-[(2-hydroxyethylamino)methyl]-14-methyl-4-oxo-10-oxa-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-5-yl] hydrogen carbonate (PubChem CID 126686246) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is [6-hydroxy-15-[(2-hydroxyethylamino)methyl]-14-methyl-4-oxo-10-oxa-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-5-yl] hydrogen carbonate.
| Compound Name | [6-hydroxy-15-[(2-hydroxyethylamino)methyl]-14-methyl-4-oxo-10-oxa-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 126686246 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [6-hydroxy-15-[(2-hydroxyethylamino)methyl]-14-methyl-4-oxo-10-oxa-3,14-diazatetracyclo[9.7.0.02,7.013,17]octadeca-1(11),2(7),5,12,15,17-hexaen-5-yl] hydrogen carbonate |
| SMILES | Cn1c(CNCCO)cc2cc3c(cc21)OCCc1c-3[nH]c(=O)c(OC(=O)O)c1O |
| InChI | InChI=1S/C20H21N3O7/c1-23-11(9-21-3-4-24)6-10-7-13-15(8-14(10)23)29-5-2-12-16(13)22-19(26)18(17(12)25)30-20(27)28/h6-8,21,24H,2-5,9H2,1H3,(H,27,28)(H2,22,25,26) |
| InChIKey | MMSXQVQJCMJDPM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|