C15H27N3 — CID 126686884
(2Z,5S)-5-N-ethyl-3-(3-imino-2-methylpropyl)-2-N-methyl-4-methylidenehepta-2,6-diene-2,5-diamine (PubChem CID 126686884) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (2Z,5S)-5-N-ethyl-3-(3-imino-2-methylpropyl)-2-N-methyl-4-methylidenehepta-2,6-diene-2,5-diamine.
| Compound Name | (2Z,5S)-5-N-ethyl-3-(3-imino-2-methylpropyl)-2-N-methyl-4-methylidenehepta-2,6-diene-2,5-diamine |
|---|---|
| PubChem CID | 126686884 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (2Z,5S)-5-N-ethyl-3-(3-imino-2-methylpropyl)-2-N-methyl-4-methylidenehepta-2,6-diene-2,5-diamine |
| SMILES | [H]/N=C/C(C)C/C(C(=C)[C@H](C=C)NCC)=C(\C)NC |
| InChI | InChI=1S/C15H27N3/c1-7-15(18-8-2)12(4)14(13(5)17-6)9-11(3)10-16/h7,10-11,15-18H,1,4,8-9H2,2-3,5-6H3/b14-13-,16-10+/t11?,15-/m0/s1 |
| InChIKey | CLHZISCCMVNGHI-PGPUXPTOSA-N |
| XLogP | 2.88 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|