C10H9N3O2 — CID 12668716
6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-amine (PubChem CID 12668716) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-amine.
| Compound Name | 6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 12668716 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 6-methyl-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
| SMILES | Cc1nc(N)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C10H9N3O2/c1-5-12-7-3-9-8(14-4-15-9)2-6(7)10(11)13-5/h2-3H,4H2,1H3,(H2,11,12,13) |
| InChIKey | JXJUSZQBHZFWGB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |