About (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine
(Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine (PubChem CID 126687195) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine |
| PubChem CID | 126687195 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine |
| SMILES | [H]/N=C/C(C)=C\C(=C(/C)N)\C(=C/C)CN |
| InChI | InChI=1S/C11H19N3/c1-4-10(7-13)11(9(3)14)5-8(2)6-12/h4-6,12H,7,13-14H2,1-3H3/b8-5-,10-4-,11-9-,12-6+ |
| InChIKey | WKZVFGLTESFWGV-DJJHNDDTSA-N |
| XLogP | 1.72 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine?
The IUPAC name of (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine (CID 126687195) is (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine.
What is the SMILES notation for (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine?
The canonical SMILES for (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine is [H]/N=C/C(C)=C\C(=C(/C)N)\C(=C/C)CN.
What is the InChIKey of (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine?
The InChIKey is WKZVFGLTESFWGV-DJJHNDDTSA-N. The full InChI is InChI=1S/C11H19N3/c1-4-10(7-13)11(9(3)14)5-8(2)6-12/h4-6,12H,7,13-14H2,1-3H3/b8-5-,10-4-,11-9-,12-6+.
What are the key properties of (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine?
(Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine has a molecular weight of 193.29 g/mol, XLogP of 1.72, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-2-ethylidene-3-[(Z)-3-imino-2-methylprop-1-enyl]pent-3-ene-1,4-diamine is sourced from PubChem (CID 126687195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).