C16H17ClFN7 — CID 126687199
1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-1-[(3S)-piperidin-3-yl]hydrazine (PubChem CID 126687199) has the molecular formula C16H17ClFN7 and a molecular weight of 361.81 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-1-[(3S)-piperidin-3-yl]hydrazine.
| Compound Name | 1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-1-[(3S)-piperidin-3-yl]hydrazine |
|---|---|
| PubChem CID | 126687199 |
| Molecular Formula | C16H17ClFN7 |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-1-[(3S)-piperidin-3-yl]hydrazine |
| SMILES | NN(c1nc(-c2c[nH]c3ncc(Cl)cc23)ncc1F)[C@H]1CCCNC1 |
| InChI | InChI=1S/C16H17ClFN7/c17-9-4-11-12(7-22-14(11)21-5-9)15-23-8-13(18)16(24-15)25(19)10-2-1-3-20-6-10/h4-5,7-8,10,20H,1-3,6,19H2,(H,21,22)/t10-/m0/s1 |
| InChIKey | CFRLTWYFZHNMND-JTQLQIEISA-N |
| XLogP | 2.24 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|