About (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine
(2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine (PubChem CID 126687315) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine.
Molecular Properties
| Compound Name | (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine |
| PubChem CID | 126687315 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine |
| SMILES | CC1=CCN[C@@H](N)C(C)=C1 |
| InChI | InChI=1S/C8H14N2/c1-6-3-4-10-8(9)7(2)5-6/h3,5,8,10H,4,9H2,1-2H3/t8-/m1/s1 |
| InChIKey | VOPYVNZZCOLBTP-MRVPVSSYSA-N |
| XLogP | 0.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine?
The IUPAC name of (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine (CID 126687315) is (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine.
What is the SMILES notation for (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine?
The canonical SMILES for (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine is CC1=CCN[C@@H](N)C(C)=C1.
What is the InChIKey of (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine?
The InChIKey is VOPYVNZZCOLBTP-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H14N2/c1-6-3-4-10-8(9)7(2)5-6/h3,5,8,10H,4,9H2,1-2H3/t8-/m1/s1.
What are the key properties of (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine?
(2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine has a molecular weight of 138.21 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,5-dimethyl-2,7-dihydro-1H-azepin-2-amine is sourced from PubChem (CID 126687315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).