About 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene
1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene (PubChem CID 126687455) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene.
Molecular Properties
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene |
| PubChem CID | 126687455 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene |
| SMILES | C=C/C=C\C1=C(N=O)CCC1 |
| InChI | InChI=1S/C9H11NO/c1-2-3-5-8-6-4-7-9(8)10-11/h2-3,5H,1,4,6-7H2/b5-3- |
| InChIKey | BVBHTBVFUZQRSF-HYXAFXHYSA-N |
| XLogP | 2.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene?
The IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene (CID 126687455) is 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene.
What is the SMILES notation for 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene?
The canonical SMILES for 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene is C=C/C=C\C1=C(N=O)CCC1.
What is the InChIKey of 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene?
The InChIKey is BVBHTBVFUZQRSF-HYXAFXHYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-3-5-8-6-4-7-9(8)10-11/h2-3,5H,1,4,6-7H2/b5-3-.
What are the key properties of 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene?
1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene has a molecular weight of 149.19 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-buta-1,3-dienyl]-2-nitrosocyclopentene is sourced from PubChem (CID 126687455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).