About (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile
(7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 126687549) has the molecular formula C10H9ClN2
and a molecular weight of 192.65 g/mol. Its IUPAC name is (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| PubChem CID | 126687549 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | C[C@@H]1CCc2c1ncc(C#N)c2Cl |
| InChI | InChI=1S/C10H9ClN2/c1-6-2-3-8-9(11)7(4-12)5-13-10(6)8/h5-6H,2-3H2,1H3/t6-/m1/s1 |
| InChIKey | RQKSTAWPYCNOLW-ZCFIWIBFSA-N |
| XLogP | 2.66 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
The IUPAC name of (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (CID 126687549) is (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
What is the SMILES notation for (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
The canonical SMILES for (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile is C[C@@H]1CCc2c1ncc(C#N)c2Cl.
What is the InChIKey of (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
The InChIKey is RQKSTAWPYCNOLW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H9ClN2/c1-6-2-3-8-9(11)7(4-12)5-13-10(6)8/h5-6H,2-3H2,1H3/t6-/m1/s1.
What are the key properties of (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile?
(7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile has a molecular weight of 192.65 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-4-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile is sourced from PubChem (CID 126687549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).