About (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide
(2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide (PubChem CID 126687555) has the molecular formula C4H4O3S
and a molecular weight of 132.14 g/mol. Its IUPAC name is (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide.
Molecular Properties
| Compound Name | (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide |
| PubChem CID | 126687555 |
| Molecular Formula | C4H4O3S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 131.99 |
| IUPAC Name | (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide |
| SMILES | C#CC1CO[S@](=O)O1 |
| InChI | InChI=1S/C4H4O3S/c1-2-4-3-6-8(5)7-4/h1,4H,3H2/t4?,8-/m0/s1 |
| InChIKey | BEBWHMIWDCDIOV-FZSOOXKGSA-N |
| XLogP | -0.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide?
The IUPAC name of (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide (CID 126687555) is (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide.
What is the SMILES notation for (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide?
The canonical SMILES for (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide is C#CC1CO[S@](=O)O1.
What is the InChIKey of (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide?
The InChIKey is BEBWHMIWDCDIOV-FZSOOXKGSA-N. The full InChI is InChI=1S/C4H4O3S/c1-2-4-3-6-8(5)7-4/h1,4H,3H2/t4?,8-/m0/s1.
What are the key properties of (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide?
(2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide has a molecular weight of 132.14 g/mol, XLogP of -0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-ethynyl-1,3,2-dioxathiolane 2-oxide is sourced from PubChem (CID 126687555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).