About 6-methyl-6-propan-2-yl-1,4-diazepine
6-methyl-6-propan-2-yl-1,4-diazepine (PubChem CID 126688078) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-methyl-6-propan-2-yl-1,4-diazepine.
Molecular Properties
| Compound Name | 6-methyl-6-propan-2-yl-1,4-diazepine |
| PubChem CID | 126688078 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 6-methyl-6-propan-2-yl-1,4-diazepine |
| SMILES | CC(C)C1(C)C=NC=CN=C1 |
| InChI | InChI=1S/C9H14N2/c1-8(2)9(3)6-10-4-5-11-7-9/h4-8H,1-3H3 |
| InChIKey | JCCNCWDNQLTXIF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-6-propan-2-yl-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6-propan-2-yl-1,4-diazepine?
The IUPAC name of 6-methyl-6-propan-2-yl-1,4-diazepine (CID 126688078) is 6-methyl-6-propan-2-yl-1,4-diazepine.
What is the SMILES notation for 6-methyl-6-propan-2-yl-1,4-diazepine?
The canonical SMILES for 6-methyl-6-propan-2-yl-1,4-diazepine is CC(C)C1(C)C=NC=CN=C1.
What is the InChIKey of 6-methyl-6-propan-2-yl-1,4-diazepine?
The InChIKey is JCCNCWDNQLTXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-8(2)9(3)6-10-4-5-11-7-9/h4-8H,1-3H3.
What are the key properties of 6-methyl-6-propan-2-yl-1,4-diazepine?
6-methyl-6-propan-2-yl-1,4-diazepine has a molecular weight of 150.22 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6-propan-2-yl-1,4-diazepine is sourced from PubChem (CID 126688078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).