About 3-methyl-9H-thioxanthene 10,10-dioxide
3-methyl-9H-thioxanthene 10,10-dioxide (PubChem CID 126688682) has the molecular formula C14H12O2S
and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-methyl-9H-thioxanthene 10,10-dioxide.
Molecular Properties
| Compound Name | 3-methyl-9H-thioxanthene 10,10-dioxide |
| PubChem CID | 126688682 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-methyl-9H-thioxanthene 10,10-dioxide |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)c1ccccc1C2 |
| InChI | InChI=1S/C14H12O2S/c1-10-6-7-12-9-11-4-2-3-5-13(11)17(15,16)14(12)8-10/h2-8H,9H2,1H3 |
| InChIKey | BJUHTZBCQSTDNZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-9H-thioxanthene 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-9H-thioxanthene 10,10-dioxide?
The IUPAC name of 3-methyl-9H-thioxanthene 10,10-dioxide (CID 126688682) is 3-methyl-9H-thioxanthene 10,10-dioxide.
What is the SMILES notation for 3-methyl-9H-thioxanthene 10,10-dioxide?
The canonical SMILES for 3-methyl-9H-thioxanthene 10,10-dioxide is Cc1ccc2c(c1)S(=O)(=O)c1ccccc1C2.
What is the InChIKey of 3-methyl-9H-thioxanthene 10,10-dioxide?
The InChIKey is BJUHTZBCQSTDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S/c1-10-6-7-12-9-11-4-2-3-5-13(11)17(15,16)14(12)8-10/h2-8H,9H2,1H3.
What are the key properties of 3-methyl-9H-thioxanthene 10,10-dioxide?
3-methyl-9H-thioxanthene 10,10-dioxide has a molecular weight of 244.32 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-9H-thioxanthene 10,10-dioxide is sourced from PubChem (CID 126688682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).