C24H29N5O2 — CID 126689215
8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-propan-2-ylimidazo[4,5-c]quinolin-2-one (PubChem CID 126689215) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-propan-2-ylimidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-propan-2-ylimidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 126689215 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 8-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-methyl-1-propan-2-ylimidazo[4,5-c]quinolin-2-one |
| SMILES | CC(C)n1c(=O)n(C)c2cnc3ccc(-c4ccc(OCCCN(C)C)nc4)cc3c21 |
| InChI | InChI=1S/C24H29N5O2/c1-16(2)29-23-19-13-17(7-9-20(19)25-15-21(23)28(5)24(29)30)18-8-10-22(26-14-18)31-12-6-11-27(3)4/h7-10,13-16H,6,11-12H2,1-5H3 |
| InChIKey | FBYDIXCPNMJMEZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|