About 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane
1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane (PubChem CID 1266902) has the molecular formula C18H20N6
and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane.
Molecular Properties
| Compound Name | 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane |
| PubChem CID | 1266902 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane |
| SMILES | c1ccc(-c2nc(N3CCCCCC3)nc(-n3ccnc3)n2)cc1 |
| InChI | InChI=1S/C18H20N6/c1-2-7-12-23(11-6-1)17-20-16(15-8-4-3-5-9-15)21-18(22-17)24-13-10-19-14-24/h3-5,8-10,13-14H,1-2,6-7,11-12H2 |
| InChIKey | RJQSGWMTLGPQKK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane?
The IUPAC name of 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane (CID 1266902) is 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane.
What is the SMILES notation for 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane?
The canonical SMILES for 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane is c1ccc(-c2nc(N3CCCCCC3)nc(-n3ccnc3)n2)cc1.
What is the InChIKey of 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane?
The InChIKey is RJQSGWMTLGPQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6/c1-2-7-12-23(11-6-1)17-20-16(15-8-4-3-5-9-15)21-18(22-17)24-13-10-19-14-24/h3-5,8-10,13-14H,1-2,6-7,11-12H2.
What are the key properties of 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane?
1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane has a molecular weight of 320.40 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-yl)azepane is sourced from PubChem (CID 1266902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).