C28H41FN4 — CID 126690232
(2Z)-N-[(Z)-1-(dimethylamino)hex-1-enyl]-N'-[(E)-3-(4-fluorophenyl)but-2-enyl]-4-piperidin-4-ylpenta-2,4-dienimidamide (PubChem CID 126690232) has the molecular formula C28H41FN4 and a molecular weight of 452.66 g/mol. Its IUPAC name is (2Z)-N-[(Z)-1-(dimethylamino)hex-1-enyl]-N'-[(E)-3-(4-fluorophenyl)but-2-enyl]-4-piperidin-4-ylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-N-[(Z)-1-(dimethylamino)hex-1-enyl]-N'-[(E)-3-(4-fluorophenyl)but-2-enyl]-4-piperidin-4-ylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 126690232 |
| Molecular Formula | C28H41FN4 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (2Z)-N-[(Z)-1-(dimethylamino)hex-1-enyl]-N'-[(E)-3-(4-fluorophenyl)but-2-enyl]-4-piperidin-4-ylpenta-2,4-dienimidamide |
| SMILES | C=C(/C=C\C(=N\C/C=C(\C)c1ccc(F)cc1)N/C(=C/CCCC)N(C)C)C1CCNCC1 |
| InChI | InChI=1S/C28H41FN4/c1-6-7-8-9-28(33(4)5)32-27(15-10-22(2)25-17-19-30-20-18-25)31-21-16-23(3)24-11-13-26(29)14-12-24/h9-16,25,30H,2,6-8,17-21H2,1,3-5H3,(H,31,32)/b15-10-,23-16+,28-9- |
| InChIKey | ZIFWICPEENSPRO-PKWLFUACSA-N |
| XLogP | 5.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|