C20H29N3OS2 — CID 126690471
N-[(2Z,4E)-5-ethyl-2-methyl-4-sulfanylhepta-2,4,6-trienyl]-4-methyl-5-(N'-propylcarbamimidoyl)thiophene-3-carboxamide (PubChem CID 126690471) has the molecular formula C20H29N3OS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is N-[(2Z,4E)-5-ethyl-2-methyl-4-sulfanylhepta-2,4,6-trienyl]-4-methyl-5-(N'-propylcarbamimidoyl)thiophene-3-carboxamide.
| Compound Name | N-[(2Z,4E)-5-ethyl-2-methyl-4-sulfanylhepta-2,4,6-trienyl]-4-methyl-5-(N'-propylcarbamimidoyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126690471 |
| Molecular Formula | C20H29N3OS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[(2Z,4E)-5-ethyl-2-methyl-4-sulfanylhepta-2,4,6-trienyl]-4-methyl-5-(N'-propylcarbamimidoyl)thiophene-3-carboxamide |
| SMILES | C=C/C(CC)=C(S)\C=C(\C)CNC(=O)c1csc(/C(N)=N/CCC)c1C |
| InChI | InChI=1S/C20H29N3OS2/c1-6-9-22-19(21)18-14(5)16(12-26-18)20(24)23-11-13(4)10-17(25)15(7-2)8-3/h7,10,12,25H,2,6,8-9,11H2,1,3-5H3,(H2,21,22)(H,23,24)/b13-10-,17-15- |
| InChIKey | ZMIMLDOZACFMQE-WQTULGNZSA-N |
| XLogP | 4.63 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|