C38H34F3N5O6 — CID 126690510
2-[[(2E,4E)-5-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-methylhepta-2,4,6-trienoyl]-[[4-[5-(1-methylindol-4-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]acetic acid (PubChem CID 126690510) has the molecular formula C38H34F3N5O6 and a molecular weight of 713.71 g/mol. Its IUPAC name is 2-[[(2E,4E)-5-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-methylhepta-2,4,6-trienoyl]-[[4-[5-(1-methylindol-4-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[(2E,4E)-5-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-methylhepta-2,4,6-trienoyl]-[[4-[5-(1-methylindol-4-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 126690510 |
| Molecular Formula | C38H34F3N5O6 |
| Molecular Weight | 713.71 g/mol |
| Exact Mass | 713.25 |
| IUPAC Name | 2-[[(2E,4E)-5-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-methylhepta-2,4,6-trienoyl]-[[4-[5-(1-methylindol-4-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]acetic acid |
| SMILES | C=C/C(=C\C=C(/C)C(=O)N(CC(=O)O)Cc1ccc(-c2noc(-c3cccc4c3ccn4C)n2)cc1)NC(=O)Cc1ccc(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C38H34F3N5O6/c1-5-27(42-33(47)19-26-14-16-28(51-4)20-31(26)38(39,40)41)15-9-23(2)37(50)46(22-34(48)49)21-24-10-12-25(13-11-24)35-43-36(52-44-35)30-7-6-8-32-29(30)17-18-45(32)3/h5-18,20H,1,19,21-22H2,2-4H3,(H,42,47)(H,48,49)/b23-9+,27-15+ |
| InChIKey | PUGZEYPFMYOTHJ-VBTITXTQSA-N |
| XLogP | 6.71 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|