C14H14IN5O2S — CID 126690562
4-[1-(cyclopropylmethyl)-2,2-dioxo-3H-[1,2,5]thiadiazolo[3,4-b]pyridin-6-yl]-N-iodopyridin-2-amine (PubChem CID 126690562) has the molecular formula C14H14IN5O2S and a molecular weight of 443.27 g/mol. Its IUPAC name is 4-[1-(cyclopropylmethyl)-2,2-dioxo-3H-[1,2,5]thiadiazolo[3,4-b]pyridin-6-yl]-N-iodopyridin-2-amine.
| Compound Name | 4-[1-(cyclopropylmethyl)-2,2-dioxo-3H-[1,2,5]thiadiazolo[3,4-b]pyridin-6-yl]-N-iodopyridin-2-amine |
|---|---|
| PubChem CID | 126690562 |
| Molecular Formula | C14H14IN5O2S |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 4-[1-(cyclopropylmethyl)-2,2-dioxo-3H-[1,2,5]thiadiazolo[3,4-b]pyridin-6-yl]-N-iodopyridin-2-amine |
| SMILES | O=S1(=O)Nc2ncc(-c3ccnc(NI)c3)cc2N1CC1CC1 |
| InChI | InChI=1S/C14H14IN5O2S/c15-18-13-6-10(3-4-16-13)11-5-12-14(17-7-11)19-23(21,22)20(12)8-9-1-2-9/h3-7,9H,1-2,8H2,(H,16,18)(H,17,19) |
| InChIKey | HEGCMDRINXRFQT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|