About (5-ethyl-1,2-dihydropyridin-6-yl)methanol
(5-ethyl-1,2-dihydropyridin-6-yl)methanol (PubChem CID 126690667) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (5-ethyl-1,2-dihydropyridin-6-yl)methanol.
Molecular Properties
| Compound Name | (5-ethyl-1,2-dihydropyridin-6-yl)methanol |
| PubChem CID | 126690667 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (5-ethyl-1,2-dihydropyridin-6-yl)methanol |
| SMILES | CCC1=C(CO)NCC=C1 |
| InChI | InChI=1S/C8H13NO/c1-2-7-4-3-5-9-8(7)6-10/h3-4,9-10H,2,5-6H2,1H3 |
| InChIKey | GFMHJNDOFVAKGT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-ethyl-1,2-dihydropyridin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,2-dihydropyridin-6-yl)methanol?
The IUPAC name of (5-ethyl-1,2-dihydropyridin-6-yl)methanol (CID 126690667) is (5-ethyl-1,2-dihydropyridin-6-yl)methanol.
What is the SMILES notation for (5-ethyl-1,2-dihydropyridin-6-yl)methanol?
The canonical SMILES for (5-ethyl-1,2-dihydropyridin-6-yl)methanol is CCC1=C(CO)NCC=C1.
What is the InChIKey of (5-ethyl-1,2-dihydropyridin-6-yl)methanol?
The InChIKey is GFMHJNDOFVAKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-2-7-4-3-5-9-8(7)6-10/h3-4,9-10H,2,5-6H2,1H3.
What are the key properties of (5-ethyl-1,2-dihydropyridin-6-yl)methanol?
(5-ethyl-1,2-dihydropyridin-6-yl)methanol has a molecular weight of 139.20 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,2-dihydropyridin-6-yl)methanol is sourced from PubChem (CID 126690667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).