About (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine
(2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine (PubChem CID 126690722) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine.
Molecular Properties
| Compound Name | (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine |
| PubChem CID | 126690722 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine |
| SMILES | C=C(/C=C\C)/C=C\C=N\C |
| InChI | InChI=1S/C9H13N/c1-4-6-9(2)7-5-8-10-3/h4-8H,2H2,1,3H3/b6-4-,7-5-,10-8+ |
| InChIKey | IPXIAEHICHKMOQ-HDFRMWMESA-N |
| XLogP | 2.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine?
The IUPAC name of (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine (CID 126690722) is (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine.
What is the SMILES notation for (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine?
The canonical SMILES for (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine is C=C(/C=C\C)/C=C\C=N\C.
What is the InChIKey of (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine?
The InChIKey is IPXIAEHICHKMOQ-HDFRMWMESA-N. The full InChI is InChI=1S/C9H13N/c1-4-6-9(2)7-5-8-10-3/h4-8H,2H2,1,3H3/b6-4-,7-5-,10-8+.
What are the key properties of (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine?
(2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine has a molecular weight of 135.21 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,5Z)-N-methyl-4-methylidenehepta-2,5-dien-1-imine is sourced from PubChem (CID 126690722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).